C13H17FO6S — CID 103179876
2-fluoro-5-[2-(3-methoxypropoxy)ethylsulfonyl]benzoic acid (PubChem CID 103179876) has the molecular formula C13H17FO6S and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-fluoro-5-[2-(3-methoxypropoxy)ethylsulfonyl]benzoic acid.
| Compound Name | 2-fluoro-5-[2-(3-methoxypropoxy)ethylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 103179876 |
| Molecular Formula | C13H17FO6S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-fluoro-5-[2-(3-methoxypropoxy)ethylsulfonyl]benzoic acid |
| SMILES | COCCCOCCS(=O)(=O)c1ccc(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H17FO6S/c1-19-5-2-6-20-7-8-21(17,18)10-3-4-12(14)11(9-10)13(15)16/h3-4,9H,2,5-8H2,1H3,(H,15,16) |
| InChIKey | GUTGAADWYAPLAE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|