C20H24ClFN2O4S — CID 70529386
5-[2-(4-chlorophenyl)ethyl-methylsulfamoyl]-2-(diethylamino)-3-fluorobenzoic acid (PubChem CID 70529386) has the molecular formula C20H24ClFN2O4S and a molecular weight of 442.94 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)ethyl-methylsulfamoyl]-2-(diethylamino)-3-fluorobenzoic acid.
| Compound Name | 5-[2-(4-chlorophenyl)ethyl-methylsulfamoyl]-2-(diethylamino)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 70529386 |
| Molecular Formula | C20H24ClFN2O4S |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 5-[2-(4-chlorophenyl)ethyl-methylsulfamoyl]-2-(diethylamino)-3-fluorobenzoic acid |
| SMILES | CCN(CC)c1c(F)cc(S(=O)(=O)N(C)CCc2ccc(Cl)cc2)cc1C(=O)O |
| InChI | InChI=1S/C20H24ClFN2O4S/c1-4-24(5-2)19-17(20(25)26)12-16(13-18(19)22)29(27,28)23(3)11-10-14-6-8-15(21)9-7-14/h6-9,12-13H,4-5,10-11H2,1-3H3,(H,25,26) |
| InChIKey | IHQJMYWITVPHQZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |