C6H6BrNO4S2 — CID 67189352
(5-bromothiophen-2-yl)sulfonyl-methylcarbamic acid (PubChem CID 67189352) has the molecular formula C6H6BrNO4S2 and a molecular weight of 300.16 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)sulfonyl-methylcarbamic acid.
| Compound Name | (5-bromothiophen-2-yl)sulfonyl-methylcarbamic acid |
|---|---|
| PubChem CID | 67189352 |
| Molecular Formula | C6H6BrNO4S2 |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 298.89 |
| IUPAC Name | (5-bromothiophen-2-yl)sulfonyl-methylcarbamic acid |
| SMILES | CN(C(=O)O)S(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C6H6BrNO4S2/c1-8(6(9)10)14(11,12)5-3-2-4(7)13-5/h2-3H,1H3,(H,9,10) |
| InChIKey | RFPVFDIKLRBWMD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |