C8H12BrNO3S2 — CID 39456166
5-bromo-N-ethyl-N-(2-hydroxyethyl)thiophene-2-sulfonamide (PubChem CID 39456166) has the molecular formula C8H12BrNO3S2 and a molecular weight of 314.23 g/mol. Its IUPAC name is 5-bromo-N-ethyl-N-(2-hydroxyethyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-ethyl-N-(2-hydroxyethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 39456166 |
| Molecular Formula | C8H12BrNO3S2 |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 312.94 |
| IUPAC Name | 5-bromo-N-ethyl-N-(2-hydroxyethyl)thiophene-2-sulfonamide |
| SMILES | CCN(CCO)S(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C8H12BrNO3S2/c1-2-10(5-6-11)15(12,13)8-4-3-7(9)14-8/h3-4,11H,2,5-6H2,1H3 |
| InChIKey | INGZHEUZJKFAEE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |