C12H19BrN2O3S2 — CID 40680174
2-[(5-bromothiophen-2-yl)sulfonyl-ethylamino]-N-tert-butylacetamide (PubChem CID 40680174) has the molecular formula C12H19BrN2O3S2 and a molecular weight of 383.33 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)sulfonyl-ethylamino]-N-tert-butylacetamide.
| Compound Name | 2-[(5-bromothiophen-2-yl)sulfonyl-ethylamino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 40680174 |
| Molecular Formula | C12H19BrN2O3S2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)sulfonyl-ethylamino]-N-tert-butylacetamide |
| SMILES | CCN(CC(=O)NC(C)(C)C)S(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C12H19BrN2O3S2/c1-5-15(8-10(16)14-12(2,3)4)20(17,18)11-7-6-9(13)19-11/h6-7H,5,8H2,1-4H3,(H,14,16) |
| InChIKey | SXIHRYGZWBRGCS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |