C9H13BrClNO3S2 — CID 80577825
5-bromo-4-chloro-N-(2-hydroxyethyl)-N-propylthiophene-2-sulfonamide (PubChem CID 80577825) has the molecular formula C9H13BrClNO3S2 and a molecular weight of 362.70 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-(2-hydroxyethyl)-N-propylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-(2-hydroxyethyl)-N-propylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80577825 |
| Molecular Formula | C9H13BrClNO3S2 |
| Molecular Weight | 362.70 g/mol |
| Exact Mass | 360.92 |
| IUPAC Name | 5-bromo-4-chloro-N-(2-hydroxyethyl)-N-propylthiophene-2-sulfonamide |
| SMILES | CCCN(CCO)S(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C9H13BrClNO3S2/c1-2-3-12(4-5-13)17(14,15)8-6-7(11)9(10)16-8/h6,13H,2-5H2,1H3 |
| InChIKey | TWRHYMMJHNMECL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.70 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |