C10H15BrClN3O4S2 — CID 80577988
3-[(5-bromo-4-chlorothiophen-2-yl)sulfonyl-(2-methoxyethyl)amino]-N'-hydroxypropanimidamide (PubChem CID 80577988) has the molecular formula C10H15BrClN3O4S2 and a molecular weight of 420.74 g/mol. Its IUPAC name is 3-[(5-bromo-4-chlorothiophen-2-yl)sulfonyl-(2-methoxyethyl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[(5-bromo-4-chlorothiophen-2-yl)sulfonyl-(2-methoxyethyl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 80577988 |
| Molecular Formula | C10H15BrClN3O4S2 |
| Molecular Weight | 420.74 g/mol |
| Exact Mass | 418.94 |
| IUPAC Name | 3-[(5-bromo-4-chlorothiophen-2-yl)sulfonyl-(2-methoxyethyl)amino]-N'-hydroxypropanimidamide |
| SMILES | COCCN(CCC(N)=NO)S(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C10H15BrClN3O4S2/c1-19-5-4-15(3-2-8(13)14-16)21(17,18)9-6-7(12)10(11)20-9/h6,16H,2-5H2,1H3,(H2,13,14) |
| InChIKey | VURDTSCPMQTWHG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.74 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|