C12H20ClN3O3S2 — CID 103100639
3-[(5-chloro-4-methylthiophen-2-yl)sulfonyl-(2-methylpropyl)amino]-N'-hydroxypropanimidamide (PubChem CID 103100639) has the molecular formula C12H20ClN3O3S2 and a molecular weight of 353.90 g/mol. Its IUPAC name is 3-[(5-chloro-4-methylthiophen-2-yl)sulfonyl-(2-methylpropyl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[(5-chloro-4-methylthiophen-2-yl)sulfonyl-(2-methylpropyl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103100639 |
| Molecular Formula | C12H20ClN3O3S2 |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 3-[(5-chloro-4-methylthiophen-2-yl)sulfonyl-(2-methylpropyl)amino]-N'-hydroxypropanimidamide |
| SMILES | Cc1cc(S(=O)(=O)N(CCC(N)=NO)CC(C)C)sc1Cl |
| InChI | InChI=1S/C12H20ClN3O3S2/c1-8(2)7-16(5-4-10(14)15-17)21(18,19)11-6-9(3)12(13)20-11/h6,8,17H,4-5,7H2,1-3H3,(H2,14,15) |
| InChIKey | ZSUBJBXSQCNRKT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|