C10H19BrN6O3S — CID 106468313
3-[(5-bromo-3-methyltriazol-4-yl)sulfonyl-(2-methylpropyl)amino]-N'-hydroxypropanimidamide (PubChem CID 106468313) has the molecular formula C10H19BrN6O3S and a molecular weight of 383.27 g/mol. Its IUPAC name is 3-[(5-bromo-3-methyltriazol-4-yl)sulfonyl-(2-methylpropyl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[(5-bromo-3-methyltriazol-4-yl)sulfonyl-(2-methylpropyl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 106468313 |
| Molecular Formula | C10H19BrN6O3S |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 3-[(5-bromo-3-methyltriazol-4-yl)sulfonyl-(2-methylpropyl)amino]-N'-hydroxypropanimidamide |
| SMILES | CC(C)CN(CCC(N)=NO)S(=O)(=O)c1c(Br)nnn1C |
| InChI | InChI=1S/C10H19BrN6O3S/c1-7(2)6-17(5-4-8(12)14-18)21(19,20)10-9(11)13-15-16(10)3/h7,18H,4-6H2,1-3H3,(H2,12,14) |
| InChIKey | GVZYLEXLOMOCIF-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|