C9H12N2O3S2 — CID 106267459
5-cyano-N-ethyl-N-(2-hydroxyethyl)thiophene-2-sulfonamide (PubChem CID 106267459) has the molecular formula C9H12N2O3S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 5-cyano-N-ethyl-N-(2-hydroxyethyl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-ethyl-N-(2-hydroxyethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106267459 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 5-cyano-N-ethyl-N-(2-hydroxyethyl)thiophene-2-sulfonamide |
| SMILES | CCN(CCO)S(=O)(=O)c1ccc(C#N)s1 |
| InChI | InChI=1S/C9H12N2O3S2/c1-2-11(5-6-12)16(13,14)9-4-3-8(7-10)15-9/h3-4,12H,2,5-6H2,1H3 |
| InChIKey | SHVHAQDJRFMCRL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |