C10H15N3O2S2 — CID 106266702
5-cyano-N-methyl-N-[3-(methylamino)propyl]thiophene-2-sulfonamide (PubChem CID 106266702) has the molecular formula C10H15N3O2S2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 5-cyano-N-methyl-N-[3-(methylamino)propyl]thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-methyl-N-[3-(methylamino)propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106266702 |
| Molecular Formula | C10H15N3O2S2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 5-cyano-N-methyl-N-[3-(methylamino)propyl]thiophene-2-sulfonamide |
| SMILES | CNCCCN(C)S(=O)(=O)c1ccc(C#N)s1 |
| InChI | InChI=1S/C10H15N3O2S2/c1-12-6-3-7-13(2)17(14,15)10-5-4-9(8-11)16-10/h4-5,12H,3,6-7H2,1-2H3 |
| InChIKey | GEUMGCFLUBALGE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|