C12H18N2O3S2 — CID 106267815
5-cyano-N-(2-hydroxyethyl)-N-pentan-3-ylthiophene-2-sulfonamide (PubChem CID 106267815) has the molecular formula C12H18N2O3S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 5-cyano-N-(2-hydroxyethyl)-N-pentan-3-ylthiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(2-hydroxyethyl)-N-pentan-3-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106267815 |
| Molecular Formula | C12H18N2O3S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 5-cyano-N-(2-hydroxyethyl)-N-pentan-3-ylthiophene-2-sulfonamide |
| SMILES | CCC(CC)N(CCO)S(=O)(=O)c1ccc(C#N)s1 |
| InChI | InChI=1S/C12H18N2O3S2/c1-3-10(4-2)14(7-8-15)19(16,17)12-6-5-11(9-13)18-12/h5-6,10,15H,3-4,7-8H2,1-2H3 |
| InChIKey | CYHDUYAXQBJRSB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |