C12H19N3O2S2 — CID 106269262
5-cyano-N-[3-(dimethylamino)propyl]-N-ethylthiophene-2-sulfonamide (PubChem CID 106269262) has the molecular formula C12H19N3O2S2 and a molecular weight of 301.44 g/mol. Its IUPAC name is 5-cyano-N-[3-(dimethylamino)propyl]-N-ethylthiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-[3-(dimethylamino)propyl]-N-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106269262 |
| Molecular Formula | C12H19N3O2S2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 5-cyano-N-[3-(dimethylamino)propyl]-N-ethylthiophene-2-sulfonamide |
| SMILES | CCN(CCCN(C)C)S(=O)(=O)c1ccc(C#N)s1 |
| InChI | InChI=1S/C12H19N3O2S2/c1-4-15(9-5-8-14(2)3)19(16,17)12-7-6-11(10-13)18-12/h6-7H,4-5,8-9H2,1-3H3 |
| InChIKey | UIOKRRHZJAJJMR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |