C8H14N4O4S2 — CID 79864717
2-amino-N-methyl-N-(2-methylsulfonylethyl)pyrimidine-5-sulfonamide (PubChem CID 79864717) has the molecular formula C8H14N4O4S2 and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-amino-N-methyl-N-(2-methylsulfonylethyl)pyrimidine-5-sulfonamide.
| Compound Name | 2-amino-N-methyl-N-(2-methylsulfonylethyl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 79864717 |
| Molecular Formula | C8H14N4O4S2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-amino-N-methyl-N-(2-methylsulfonylethyl)pyrimidine-5-sulfonamide |
| SMILES | CN(CCS(C)(=O)=O)S(=O)(=O)c1cnc(N)nc1 |
| InChI | InChI=1S/C8H14N4O4S2/c1-12(3-4-17(2,13)14)18(15,16)7-5-10-8(9)11-6-7/h5-6H,3-4H2,1-2H3,(H2,9,10,11) |
| InChIKey | ZQJBJPRPOJSSPG-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |