C9H17N3O4S2 — CID 79863901
5-(aminomethyl)-N-methyl-N-(2-methylsulfonylethyl)-1H-pyrrole-3-sulfonamide (PubChem CID 79863901) has the molecular formula C9H17N3O4S2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 5-(aminomethyl)-N-methyl-N-(2-methylsulfonylethyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-methyl-N-(2-methylsulfonylethyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 79863901 |
| Molecular Formula | C9H17N3O4S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 5-(aminomethyl)-N-methyl-N-(2-methylsulfonylethyl)-1H-pyrrole-3-sulfonamide |
| SMILES | CN(CCS(C)(=O)=O)S(=O)(=O)c1c[nH]c(CN)c1 |
| InChI | InChI=1S/C9H17N3O4S2/c1-12(3-4-17(2,13)14)18(15,16)9-5-8(6-10)11-7-9/h5,7,11H,3-4,6,10H2,1-2H3 |
| InChIKey | OVDPDELHGKXQGC-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |