C12H21N3O2S2 — CID 112667294
5-[(cyclopropylamino)methyl]-N-methyl-N-(2-methylsulfanylethyl)-1H-pyrrole-3-sulfonamide (PubChem CID 112667294) has the molecular formula C12H21N3O2S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-N-methyl-N-(2-methylsulfanylethyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-[(cyclopropylamino)methyl]-N-methyl-N-(2-methylsulfanylethyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 112667294 |
| Molecular Formula | C12H21N3O2S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-N-methyl-N-(2-methylsulfanylethyl)-1H-pyrrole-3-sulfonamide |
| SMILES | CSCCN(C)S(=O)(=O)c1c[nH]c(CNC2CC2)c1 |
| InChI | InChI=1S/C12H21N3O2S2/c1-15(5-6-18-2)19(16,17)12-7-11(14-9-12)8-13-10-3-4-10/h7,9-10,13-14H,3-6,8H2,1-2H3 |
| InChIKey | PVQXZFKSICUDJE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |