C12H25NO2S — CID 170081112
N-(cyclopropylmethyl)-N-[(2R)-5-methylhexan-2-yl]methanesulfonamide (PubChem CID 170081112) has the molecular formula C12H25NO2S and a molecular weight of 247.40 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-[(2R)-5-methylhexan-2-yl]methanesulfonamide.
| Compound Name | N-(cyclopropylmethyl)-N-[(2R)-5-methylhexan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 170081112 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | N-(cyclopropylmethyl)-N-[(2R)-5-methylhexan-2-yl]methanesulfonamide |
| SMILES | CC(C)CC[C@@H](C)N(CC1CC1)S(C)(=O)=O |
| InChI | InChI=1S/C12H25NO2S/c1-10(2)5-6-11(3)13(16(4,14)15)9-12-7-8-12/h10-12H,5-9H2,1-4H3/t11-/m1/s1 |
| InChIKey | LLTBBLXAGBQSRP-LLVKDONJSA-N |
| XLogP | 2.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |