C6H15NO5 — CID 175287587
1-[1,2-dihydroxyethyl(2-hydroxyethyl)amino]ethane-1,2-diol (PubChem CID 175287587) has the molecular formula C6H15NO5 and a molecular weight of 181.19 g/mol. Its IUPAC name is 1-[1,2-dihydroxyethyl(2-hydroxyethyl)amino]ethane-1,2-diol.
| Compound Name | 1-[1,2-dihydroxyethyl(2-hydroxyethyl)amino]ethane-1,2-diol |
|---|---|
| PubChem CID | 175287587 |
| Molecular Formula | C6H15NO5 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 1-[1,2-dihydroxyethyl(2-hydroxyethyl)amino]ethane-1,2-diol |
| SMILES | OCCN(C(O)CO)C(O)CO |
| InChI | InChI=1S/C6H15NO5/c8-2-1-7(5(11)3-9)6(12)4-10/h5-6,8-12H,1-4H2 |
| InChIKey | OKHUYDNXGZYXHL-UHFFFAOYSA-N |
| XLogP | -3.10 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|