C7H19NO4 — CID 87640788
2-(dimethylamino)ethanol;propane-1,2,3-triol (PubChem CID 87640788) has the molecular formula C7H19NO4 and a molecular weight of 181.23 g/mol. Its IUPAC name is 2-(dimethylamino)ethanol;propane-1,2,3-triol.
| Compound Name | 2-(dimethylamino)ethanol;propane-1,2,3-triol |
|---|---|
| PubChem CID | 87640788 |
| Molecular Formula | C7H19NO4 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 2-(dimethylamino)ethanol;propane-1,2,3-triol |
| SMILES | CN(C)CCO.OCC(O)CO |
| InChI | InChI=1S/C4H11NO.C3H8O3/c1-5(2)3-4-6;4-1-3(6)2-5/h6H,3-4H2,1-2H3;3-6H,1-2H2 |
| InChIKey | DBGPFPPXWJYPHB-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |