C11H27NO3 — CID 174958117
2-(dimethylamino)ethanol;heptane-1,3-diol (PubChem CID 174958117) has the molecular formula C11H27NO3 and a molecular weight of 221.34 g/mol. Its IUPAC name is 2-(dimethylamino)ethanol;heptane-1,3-diol.
| Compound Name | 2-(dimethylamino)ethanol;heptane-1,3-diol |
|---|---|
| PubChem CID | 174958117 |
| Molecular Formula | C11H27NO3 |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.20 |
| IUPAC Name | 2-(dimethylamino)ethanol;heptane-1,3-diol |
| SMILES | CCCCC(O)CCO.CN(C)CCO |
| InChI | InChI=1S/C7H16O2.C4H11NO/c1-2-3-4-7(9)5-6-8;1-5(2)3-4-6/h7-9H,2-6H2,1H3;6H,3-4H2,1-2H3 |
| InChIKey | SKKGFVHDAWOQIP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |