About ethane-1,2-diol;octan-4-ol
ethane-1,2-diol;octan-4-ol (PubChem CID 174867706) has the molecular formula C10H24O3
and a molecular weight of 192.30 g/mol. Its IUPAC name is ethane-1,2-diol;octan-4-ol.
Molecular Properties
| Compound Name | ethane-1,2-diol;octan-4-ol |
| PubChem CID | 174867706 |
| Molecular Formula | C10H24O3 |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.17 |
| IUPAC Name | ethane-1,2-diol;octan-4-ol |
| SMILES | CCCCC(O)CCC.OCCO |
| InChI | InChI=1S/C8H18O.C2H6O2/c1-3-5-7-8(9)6-4-2;3-1-2-4/h8-9H,3-7H2,1-2H3;3-4H,1-2H2 |
| InChIKey | JVXHDPZSSUHNBT-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane-1,2-diol;octan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;octan-4-ol?
The IUPAC name of ethane-1,2-diol;octan-4-ol (CID 174867706) is ethane-1,2-diol;octan-4-ol.
What is the SMILES notation for ethane-1,2-diol;octan-4-ol?
The canonical SMILES for ethane-1,2-diol;octan-4-ol is CCCCC(O)CCC.OCCO.
What is the InChIKey of ethane-1,2-diol;octan-4-ol?
The InChIKey is JVXHDPZSSUHNBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.C2H6O2/c1-3-5-7-8(9)6-4-2;3-1-2-4/h8-9H,3-7H2,1-2H3;3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;octan-4-ol?
ethane-1,2-diol;octan-4-ol has a molecular weight of 192.30 g/mol, XLogP of 1.31, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;octan-4-ol is sourced from PubChem (CID 174867706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).