C11H25NO4 — CID 171541613
5-[3,5-dihydroxypentyl(methyl)amino]pentane-1,3-diol (PubChem CID 171541613) has the molecular formula C11H25NO4 and a molecular weight of 235.32 g/mol. Its IUPAC name is 5-[3,5-dihydroxypentyl(methyl)amino]pentane-1,3-diol.
| Compound Name | 5-[3,5-dihydroxypentyl(methyl)amino]pentane-1,3-diol |
|---|---|
| PubChem CID | 171541613 |
| Molecular Formula | C11H25NO4 |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 5-[3,5-dihydroxypentyl(methyl)amino]pentane-1,3-diol |
| SMILES | CN(CCC(O)CCO)CCC(O)CCO |
| InChI | InChI=1S/C11H25NO4/c1-12(6-2-10(15)4-8-13)7-3-11(16)5-9-14/h10-11,13-16H,2-9H2,1H3 |
| InChIKey | FUTNKLPCIWWQOE-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |