C9H25NO2 — CID 169191994
ethane;2-[2-hydroxyethyl(methyl)amino]ethanol (PubChem CID 169191994) has the molecular formula C9H25NO2 and a molecular weight of 179.30 g/mol. Its IUPAC name is ethane;2-[2-hydroxyethyl(methyl)amino]ethanol.
| Compound Name | ethane;2-[2-hydroxyethyl(methyl)amino]ethanol |
|---|---|
| PubChem CID | 169191994 |
| Molecular Formula | C9H25NO2 |
| Molecular Weight | 179.30 g/mol |
| Exact Mass | 179.19 |
| IUPAC Name | ethane;2-[2-hydroxyethyl(methyl)amino]ethanol |
| SMILES | CC.CC.CN(CCO)CCO |
| InChI | InChI=1S/C5H13NO2.2C2H6/c1-6(2-4-7)3-5-8;2*1-2/h7-8H,2-5H2,1H3;2*1-2H3 |
| InChIKey | ZRRHPTGKHWEAEB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |