C5H16N2O5S — CID 174686265
2-[2-hydroxyethyl(methyl)amino]ethanol;sulfamic acid (PubChem CID 174686265) has the molecular formula C5H16N2O5S and a molecular weight of 216.26 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(methyl)amino]ethanol;sulfamic acid.
| Compound Name | 2-[2-hydroxyethyl(methyl)amino]ethanol;sulfamic acid |
|---|---|
| PubChem CID | 174686265 |
| Molecular Formula | C5H16N2O5S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 2-[2-hydroxyethyl(methyl)amino]ethanol;sulfamic acid |
| SMILES | CN(CCO)CCO.NS(=O)(=O)O |
| InChI | InChI=1S/C5H13NO2.H3NO3S/c1-6(2-4-7)3-5-8;1-5(2,3)4/h7-8H,2-5H2,1H3;(H3,1,2,3,4) |
| InChIKey | HYQQIKJGSPFKNZ-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|