About hydron;2-[2-hydroxyethyl(methyl)amino]ethanol;tetrafluoroborate
hydron;2-[2-hydroxyethyl(methyl)amino]ethanol;tetrafluoroborate (PubChem CID 174603655) has the molecular formula C5H14BF4NO2
and a molecular weight of 206.98 g/mol. Its IUPAC name is hydron;2-[2-hydroxyethyl(methyl)amino]ethanol;tetrafluoroborate.
Molecular Properties
| Compound Name | hydron;2-[2-hydroxyethyl(methyl)amino]ethanol;tetrafluoroborate |
| PubChem CID | 174603655 |
| Molecular Formula | C5H14BF4NO2 |
| Molecular Weight | 206.98 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | hydron;2-[2-hydroxyethyl(methyl)amino]ethanol;tetrafluoroborate |
| SMILES | CN(CCO)CCO.F[B-](F)(F)F.[H+] |
| InChI | InChI=1S/C5H13NO2.BF4/c1-6(2-4-7)3-5-8;2-1(3,4)5/h7-8H,2-5H2,1H3;/q;-1/p+1 |
| InChIKey | ULCBULLKTDNNJU-UHFFFAOYSA-O |
| XLogP | 0.32 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.98 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hydron;2-[2-hydroxyethyl(methyl)amino]ethanol;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;2-[2-hydroxyethyl(methyl)amino]ethanol;tetrafluoroborate?
The IUPAC name of hydron;2-[2-hydroxyethyl(methyl)amino]ethanol;tetrafluoroborate (CID 174603655) is hydron;2-[2-hydroxyethyl(methyl)amino]ethanol;tetrafluoroborate.
What is the SMILES notation for hydron;2-[2-hydroxyethyl(methyl)amino]ethanol;tetrafluoroborate?
The canonical SMILES for hydron;2-[2-hydroxyethyl(methyl)amino]ethanol;tetrafluoroborate is CN(CCO)CCO.F[B-](F)(F)F.[H+].
What is the InChIKey of hydron;2-[2-hydroxyethyl(methyl)amino]ethanol;tetrafluoroborate?
The InChIKey is ULCBULLKTDNNJU-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H13NO2.BF4/c1-6(2-4-7)3-5-8;2-1(3,4)5/h7-8H,2-5H2,1H3;/q;-1/p+1.
What are the key properties of hydron;2-[2-hydroxyethyl(methyl)amino]ethanol;tetrafluoroborate?
hydron;2-[2-hydroxyethyl(methyl)amino]ethanol;tetrafluoroborate has a molecular weight of 206.98 g/mol, XLogP of 0.32, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;2-[2-hydroxyethyl(methyl)amino]ethanol;tetrafluoroborate is sourced from PubChem (CID 174603655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).