About CID 59270461
CID 59270461 (PubChem CID 59270461) has the molecular formula C5H11NO
and a molecular weight of 101.15 g/mol.
Molecular Properties
| Compound Name | CID 59270461 |
| PubChem CID | 59270461 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.08 |
| IUPAC Name | — |
| SMILES | [CH]CN(C)CCO |
| InChI | InChI=1S/C5H11NO/c1-3-6(2)4-5-7/h1,7H,3-5H2,2H3 |
| InChIKey | IUWCINDUTGGRAS-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59270461 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59270461?
The IUPAC name of CID 59270461 (CID 59270461) is not available.
What is the SMILES notation for CID 59270461?
The canonical SMILES for CID 59270461 is [CH]CN(C)CCO.
What is the InChIKey of CID 59270461?
The InChIKey is IUWCINDUTGGRAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO/c1-3-6(2)4-5-7/h1,7H,3-5H2,2H3.
What are the key properties of CID 59270461?
CID 59270461 has a molecular weight of 101.15 g/mol, XLogP of -0.38, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59270461 is sourced from PubChem (CID 59270461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).