About copper;bis(2-[2-hydroxyethyl(methyl)amino]acetic acid)
copper;bis(2-[2-hydroxyethyl(methyl)amino]acetic acid) (PubChem CID 56841196) has the molecular formula C10H22CuN2O6
and a molecular weight of 329.84 g/mol. Its IUPAC name is copper;bis(2-[2-hydroxyethyl(methyl)amino]acetic acid).
Molecular Properties
| Compound Name | copper;bis(2-[2-hydroxyethyl(methyl)amino]acetic acid) |
| PubChem CID | 56841196 |
| Molecular Formula | C10H22CuN2O6 |
| Molecular Weight | 329.84 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | copper;bis(2-[2-hydroxyethyl(methyl)amino]acetic acid) |
| SMILES | CN(CCO)CC(=O)O.CN(CCO)CC(=O)O.[Cu] |
| InChI | InChI=1S/2C5H11NO3.Cu/c2*1-6(2-3-7)4-5(8)9;/h2*7H,2-4H2,1H3,(H,8,9); |
| InChIKey | RYIICSGIGLHJDB-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.84 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze copper;bis(2-[2-hydroxyethyl(methyl)amino]acetic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis(2-[2-hydroxyethyl(methyl)amino]acetic acid)?
The IUPAC name of copper;bis(2-[2-hydroxyethyl(methyl)amino]acetic acid) (CID 56841196) is copper;bis(2-[2-hydroxyethyl(methyl)amino]acetic acid).
What is the SMILES notation for copper;bis(2-[2-hydroxyethyl(methyl)amino]acetic acid)?
The canonical SMILES for copper;bis(2-[2-hydroxyethyl(methyl)amino]acetic acid) is CN(CCO)CC(=O)O.CN(CCO)CC(=O)O.[Cu].
What is the InChIKey of copper;bis(2-[2-hydroxyethyl(methyl)amino]acetic acid)?
The InChIKey is RYIICSGIGLHJDB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11NO3.Cu/c2*1-6(2-3-7)4-5(8)9;/h2*7H,2-4H2,1H3,(H,8,9);.
What are the key properties of copper;bis(2-[2-hydroxyethyl(methyl)amino]acetic acid)?
copper;bis(2-[2-hydroxyethyl(methyl)amino]acetic acid) has a molecular weight of 329.84 g/mol, XLogP of -2.01, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis(2-[2-hydroxyethyl(methyl)amino]acetic acid) is sourced from PubChem (CID 56841196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).