C13H29NO7S2 — CID 89397530
4-[2-[2-hydroxyethyl(methyl)amino]ethyl]-4-methylheptane-1,7-disulfonic acid (PubChem CID 89397530) has the molecular formula C13H29NO7S2 and a molecular weight of 375.51 g/mol. Its IUPAC name is 4-[2-[2-hydroxyethyl(methyl)amino]ethyl]-4-methylheptane-1,7-disulfonic acid.
| Compound Name | 4-[2-[2-hydroxyethyl(methyl)amino]ethyl]-4-methylheptane-1,7-disulfonic acid |
|---|---|
| PubChem CID | 89397530 |
| Molecular Formula | C13H29NO7S2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 4-[2-[2-hydroxyethyl(methyl)amino]ethyl]-4-methylheptane-1,7-disulfonic acid |
| SMILES | CN(CCO)CCC(C)(CCCS(=O)(=O)O)CCCS(=O)(=O)O |
| InChI | InChI=1S/C13H29NO7S2/c1-13(5-3-11-22(16,17)18,6-4-12-23(19,20)21)7-8-14(2)9-10-15/h15H,3-12H2,1-2H3,(H,16,17,18)(H,19,20,21) |
| InChIKey | IOTJNCSACOEFHZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|