C11H22N2O — CID 87572084
2-[2-[bis(prop-2-enyl)amino]ethyl-methylamino]ethanol (PubChem CID 87572084) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-[2-[bis(prop-2-enyl)amino]ethyl-methylamino]ethanol.
| Compound Name | 2-[2-[bis(prop-2-enyl)amino]ethyl-methylamino]ethanol |
|---|---|
| PubChem CID | 87572084 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 2-[2-[bis(prop-2-enyl)amino]ethyl-methylamino]ethanol |
| SMILES | C=CCN(CC=C)CCN(C)CCO |
| InChI | InChI=1S/C11H22N2O/c1-4-6-13(7-5-2)9-8-12(3)10-11-14/h4-5,14H,1-2,6-11H2,3H3 |
| InChIKey | JCAGGRPOPOQODI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|