About ethoxyperoxyethane;2-[2-hydroxyethyl(prop-2-enyl)amino]ethanol
ethoxyperoxyethane;2-[2-hydroxyethyl(prop-2-enyl)amino]ethanol (PubChem CID 175390899) has the molecular formula C11H25NO5
and a molecular weight of 251.32 g/mol. Its IUPAC name is ethoxyperoxyethane;2-[2-hydroxyethyl(prop-2-enyl)amino]ethanol.
Molecular Properties
| Compound Name | ethoxyperoxyethane;2-[2-hydroxyethyl(prop-2-enyl)amino]ethanol |
| PubChem CID | 175390899 |
| Molecular Formula | C11H25NO5 |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | ethoxyperoxyethane;2-[2-hydroxyethyl(prop-2-enyl)amino]ethanol |
| SMILES | C=CCN(CCO)CCO.CCOOOCC |
| InChI | InChI=1S/C7H15NO2.C4H10O3/c1-2-3-8(4-6-9)5-7-10;1-3-5-7-6-4-2/h2,9-10H,1,3-7H2;3-4H2,1-2H3 |
| InChIKey | XUELGLWNJSMORN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethoxyperoxyethane;2-[2-hydroxyethyl(prop-2-enyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyperoxyethane;2-[2-hydroxyethyl(prop-2-enyl)amino]ethanol?
The IUPAC name of ethoxyperoxyethane;2-[2-hydroxyethyl(prop-2-enyl)amino]ethanol (CID 175390899) is ethoxyperoxyethane;2-[2-hydroxyethyl(prop-2-enyl)amino]ethanol.
What is the SMILES notation for ethoxyperoxyethane;2-[2-hydroxyethyl(prop-2-enyl)amino]ethanol?
The canonical SMILES for ethoxyperoxyethane;2-[2-hydroxyethyl(prop-2-enyl)amino]ethanol is C=CCN(CCO)CCO.CCOOOCC.
What is the InChIKey of ethoxyperoxyethane;2-[2-hydroxyethyl(prop-2-enyl)amino]ethanol?
The InChIKey is XUELGLWNJSMORN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.C4H10O3/c1-2-3-8(4-6-9)5-7-10;1-3-5-7-6-4-2/h2,9-10H,1,3-7H2;3-4H2,1-2H3.
What are the key properties of ethoxyperoxyethane;2-[2-hydroxyethyl(prop-2-enyl)amino]ethanol?
ethoxyperoxyethane;2-[2-hydroxyethyl(prop-2-enyl)amino]ethanol has a molecular weight of 251.32 g/mol, XLogP of 0.37, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyperoxyethane;2-[2-hydroxyethyl(prop-2-enyl)amino]ethanol is sourced from PubChem (CID 175390899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).