About 2-(dimethylamino)ethanol;ethanol;zirconium
2-(dimethylamino)ethanol;ethanol;zirconium (PubChem CID 154069577) has the molecular formula C10H29NO4Zr
and a molecular weight of 318.57 g/mol. Its IUPAC name is 2-(dimethylamino)ethanol;ethanol;zirconium.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethanol;ethanol;zirconium |
| PubChem CID | 154069577 |
| Molecular Formula | C10H29NO4Zr |
| Molecular Weight | 318.57 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-(dimethylamino)ethanol;ethanol;zirconium |
| SMILES | CCO.CCO.CCO.CN(C)CCO.[Zr] |
| InChI | InChI=1S/C4H11NO.3C2H6O.Zr/c1-5(2)3-4-6;3*1-2-3;/h6H,3-4H2,1-2H3;3*3H,2H2,1H3; |
| InChIKey | DRZUPTCUGFXNFT-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.57 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(dimethylamino)ethanol;ethanol;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethanol;ethanol;zirconium?
The IUPAC name of 2-(dimethylamino)ethanol;ethanol;zirconium (CID 154069577) is 2-(dimethylamino)ethanol;ethanol;zirconium.
What is the SMILES notation for 2-(dimethylamino)ethanol;ethanol;zirconium?
The canonical SMILES for 2-(dimethylamino)ethanol;ethanol;zirconium is CCO.CCO.CCO.CN(C)CCO.[Zr].
What is the InChIKey of 2-(dimethylamino)ethanol;ethanol;zirconium?
The InChIKey is DRZUPTCUGFXNFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO.3C2H6O.Zr/c1-5(2)3-4-6;3*1-2-3;/h6H,3-4H2,1-2H3;3*3H,2H2,1H3;.
What are the key properties of 2-(dimethylamino)ethanol;ethanol;zirconium?
2-(dimethylamino)ethanol;ethanol;zirconium has a molecular weight of 318.57 g/mol, XLogP of -0.47, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethanol;ethanol;zirconium is sourced from PubChem (CID 154069577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).