About 2-(dimethylamino)ethanol;2-(ethylamino)ethanol
2-(dimethylamino)ethanol;2-(ethylamino)ethanol (PubChem CID 88639908) has the molecular formula C8H22N2O2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-(dimethylamino)ethanol;2-(ethylamino)ethanol.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethanol;2-(ethylamino)ethanol |
| PubChem CID | 88639908 |
| Molecular Formula | C8H22N2O2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 2-(dimethylamino)ethanol;2-(ethylamino)ethanol |
| SMILES | CCNCCO.CN(C)CCO |
| InChI | InChI=1S/2C4H11NO/c1-5(2)3-4-6;1-2-5-3-4-6/h6H,3-4H2,1-2H3;5-6H,2-4H2,1H3 |
| InChIKey | RJAVNRLDHJKLDN-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethanol;2-(ethylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethanol;2-(ethylamino)ethanol?
The IUPAC name of 2-(dimethylamino)ethanol;2-(ethylamino)ethanol (CID 88639908) is 2-(dimethylamino)ethanol;2-(ethylamino)ethanol.
What is the SMILES notation for 2-(dimethylamino)ethanol;2-(ethylamino)ethanol?
The canonical SMILES for 2-(dimethylamino)ethanol;2-(ethylamino)ethanol is CCNCCO.CN(C)CCO.
What is the InChIKey of 2-(dimethylamino)ethanol;2-(ethylamino)ethanol?
The InChIKey is RJAVNRLDHJKLDN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H11NO/c1-5(2)3-4-6;1-2-5-3-4-6/h6H,3-4H2,1-2H3;5-6H,2-4H2,1H3.
What are the key properties of 2-(dimethylamino)ethanol;2-(ethylamino)ethanol?
2-(dimethylamino)ethanol;2-(ethylamino)ethanol has a molecular weight of 178.28 g/mol, XLogP of -0.87, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethanol;2-(ethylamino)ethanol is sourced from PubChem (CID 88639908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).