C11H25NO6S — CID 170174267
hydroxy-[2-hydroxyethyl-[3-(hydroxymethyl)-5-methylhexan-3-yl]amino]methanesulfonic acid (PubChem CID 170174267) has the molecular formula C11H25NO6S and a molecular weight of 299.39 g/mol. Its IUPAC name is hydroxy-[2-hydroxyethyl-[3-(hydroxymethyl)-5-methylhexan-3-yl]amino]methanesulfonic acid.
| Compound Name | hydroxy-[2-hydroxyethyl-[3-(hydroxymethyl)-5-methylhexan-3-yl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 170174267 |
| Molecular Formula | C11H25NO6S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | hydroxy-[2-hydroxyethyl-[3-(hydroxymethyl)-5-methylhexan-3-yl]amino]methanesulfonic acid |
| SMILES | CCC(CO)(CC(C)C)N(CCO)C(O)S(=O)(=O)O |
| InChI | InChI=1S/C11H25NO6S/c1-4-11(8-14,7-9(2)3)12(5-6-13)10(15)19(16,17)18/h9-10,13-15H,4-8H2,1-3H3,(H,16,17,18) |
| InChIKey | XCKVZXMORDHUOQ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|