C10H22N4 — CID 105418711
1-[[1-(dimethylamino)cyclobutyl]methyl]-1,2-dimethylguanidine (PubChem CID 105418711) has the molecular formula C10H22N4 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-[[1-(dimethylamino)cyclobutyl]methyl]-1,2-dimethylguanidine.
| Compound Name | 1-[[1-(dimethylamino)cyclobutyl]methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 105418711 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | 1-[[1-(dimethylamino)cyclobutyl]methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\N)N(C)CC1(N(C)C)CCC1 |
| InChI | InChI=1S/C10H22N4/c1-12-9(11)14(4)8-10(13(2)3)6-5-7-10/h5-8H2,1-4H3,(H2,11,12) |
| InChIKey | XTUZCELSIPHGKY-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|