C10H21N3S — CID 105413660
1-[[1-(dimethylamino)cyclobutyl]methyl]-1,3-dimethylthiourea (PubChem CID 105413660) has the molecular formula C10H21N3S and a molecular weight of 215.37 g/mol. Its IUPAC name is 1-[[1-(dimethylamino)cyclobutyl]methyl]-1,3-dimethylthiourea.
| Compound Name | 1-[[1-(dimethylamino)cyclobutyl]methyl]-1,3-dimethylthiourea |
|---|---|
| PubChem CID | 105413660 |
| Molecular Formula | C10H21N3S |
| Molecular Weight | 215.37 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 1-[[1-(dimethylamino)cyclobutyl]methyl]-1,3-dimethylthiourea |
| SMILES | CNC(=S)N(C)CC1(N(C)C)CCC1 |
| InChI | InChI=1S/C10H21N3S/c1-11-9(14)13(4)8-10(12(2)3)6-5-7-10/h5-8H2,1-4H3,(H,11,14) |
| InChIKey | PSBVGQHPAMWTLG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|