C9H20N4O2 — CID 79162393
1-(3-amino-3-hydroxyiminopropyl)-1,3-diethyl-3-methylurea (PubChem CID 79162393) has the molecular formula C9H20N4O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(3-amino-3-hydroxyiminopropyl)-1,3-diethyl-3-methylurea.
| Compound Name | 1-(3-amino-3-hydroxyiminopropyl)-1,3-diethyl-3-methylurea |
|---|---|
| PubChem CID | 79162393 |
| Molecular Formula | C9H20N4O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-(3-amino-3-hydroxyiminopropyl)-1,3-diethyl-3-methylurea |
| SMILES | CCN(C)C(=O)N(CC)CCC(N)=NO |
| InChI | InChI=1S/C9H20N4O2/c1-4-12(3)9(14)13(5-2)7-6-8(10)11-15/h15H,4-7H2,1-3H3,(H2,10,11) |
| InChIKey | WIKSZVNDJGCMMF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|