C9H19N3O4S — CID 104521764
N-(3-amino-3-hydroxyiminopropyl)-N-ethyl-2-methylsulfonylpropanamide (PubChem CID 104521764) has the molecular formula C9H19N3O4S and a molecular weight of 265.33 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyiminopropyl)-N-ethyl-2-methylsulfonylpropanamide.
| Compound Name | N-(3-amino-3-hydroxyiminopropyl)-N-ethyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 104521764 |
| Molecular Formula | C9H19N3O4S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-(3-amino-3-hydroxyiminopropyl)-N-ethyl-2-methylsulfonylpropanamide |
| SMILES | CCN(CCC(N)=NO)C(=O)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C9H19N3O4S/c1-4-12(6-5-8(10)11-14)9(13)7(2)17(3,15)16/h7,14H,4-6H2,1-3H3,(H2,10,11) |
| InChIKey | BWEIXTQRDJTEQE-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|