C10H21N3O4S — CID 77015110
N-(3-amino-3-hydroxyiminopropyl)-N-(2-methylpropyl)-2-methylsulfonylacetamide (PubChem CID 77015110) has the molecular formula C10H21N3O4S and a molecular weight of 279.36 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyiminopropyl)-N-(2-methylpropyl)-2-methylsulfonylacetamide.
| Compound Name | N-(3-amino-3-hydroxyiminopropyl)-N-(2-methylpropyl)-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 77015110 |
| Molecular Formula | C10H21N3O4S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-(3-amino-3-hydroxyiminopropyl)-N-(2-methylpropyl)-2-methylsulfonylacetamide |
| SMILES | CC(C)CN(CCC(N)=NO)C(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C10H21N3O4S/c1-8(2)6-13(5-4-9(11)12-15)10(14)7-18(3,16)17/h8,15H,4-7H2,1-3H3,(H2,11,12) |
| InChIKey | ICCWRVDWBWTFPN-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|