C9H18N2O3S2 — CID 104519364
N-(3-amino-3-sulfanylidenepropyl)-N-ethyl-2-methylsulfonylpropanamide (PubChem CID 104519364) has the molecular formula C9H18N2O3S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-N-ethyl-2-methylsulfonylpropanamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-N-ethyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 104519364 |
| Molecular Formula | C9H18N2O3S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-N-ethyl-2-methylsulfonylpropanamide |
| SMILES | CCN(CCC(N)=S)C(=O)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C9H18N2O3S2/c1-4-11(6-5-8(10)15)9(12)7(2)16(3,13)14/h7H,4-6H2,1-3H3,(H2,10,15) |
| InChIKey | PTUVHPGDFHYZTG-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|