C8H17NO5S — CID 115772414
N,N-bis(2-hydroxyethyl)-2-methylsulfonylpropanamide (PubChem CID 115772414) has the molecular formula C8H17NO5S and a molecular weight of 239.29 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-2-methylsulfonylpropanamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 115772414 |
| Molecular Formula | C8H17NO5S |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-2-methylsulfonylpropanamide |
| SMILES | CC(C(=O)N(CCO)CCO)S(C)(=O)=O |
| InChI | InChI=1S/C8H17NO5S/c1-7(15(2,13)14)8(12)9(3-5-10)4-6-11/h7,10-11H,3-6H2,1-2H3 |
| InChIKey | MCRIEXNPWMWZDO-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |