C9H19NO5S — CID 115772770
N-(2-hydroxyethyl)-N-(2-methoxyethyl)-2-methylsulfonylpropanamide (PubChem CID 115772770) has the molecular formula C9H19NO5S and a molecular weight of 253.32 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-(2-methoxyethyl)-2-methylsulfonylpropanamide.
| Compound Name | N-(2-hydroxyethyl)-N-(2-methoxyethyl)-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 115772770 |
| Molecular Formula | C9H19NO5S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | N-(2-hydroxyethyl)-N-(2-methoxyethyl)-2-methylsulfonylpropanamide |
| SMILES | COCCN(CCO)C(=O)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C9H19NO5S/c1-8(16(3,13)14)9(12)10(4-6-11)5-7-15-2/h8,11H,4-7H2,1-3H3 |
| InChIKey | NQAMLPQSBZEULI-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |