C8H15Cl2NO3S — CID 104520204
N,N-bis(2-chloroethyl)-2-methylsulfonylpropanamide (PubChem CID 104520204) has the molecular formula C8H15Cl2NO3S and a molecular weight of 276.19 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-2-methylsulfonylpropanamide.
| Compound Name | N,N-bis(2-chloroethyl)-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 104520204 |
| Molecular Formula | C8H15Cl2NO3S |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | N,N-bis(2-chloroethyl)-2-methylsulfonylpropanamide |
| SMILES | CC(C(=O)N(CCCl)CCCl)S(C)(=O)=O |
| InChI | InChI=1S/C8H15Cl2NO3S/c1-7(15(2,13)14)8(12)11(5-3-9)6-4-10/h7H,3-6H2,1-2H3 |
| InChIKey | OVYZLFDFRQKYFV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|