C10H19Cl2NO — CID 79018634
N,N-bis(2-chloroethyl)-2-ethylbutanamide (PubChem CID 79018634) has the molecular formula C10H19Cl2NO and a molecular weight of 240.17 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-2-ethylbutanamide.
| Compound Name | N,N-bis(2-chloroethyl)-2-ethylbutanamide |
|---|---|
| PubChem CID | 79018634 |
| Molecular Formula | C10H19Cl2NO |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | N,N-bis(2-chloroethyl)-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)N(CCCl)CCCl |
| InChI | InChI=1S/C10H19Cl2NO/c1-3-9(4-2)10(14)13(7-5-11)8-6-12/h9H,3-8H2,1-2H3 |
| InChIKey | XDRAGCRGZAWNMS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|