C8H9Cl2F6NO — CID 103310045
N,N-bis(2-chloroethyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide (PubChem CID 103310045) has the molecular formula C8H9Cl2F6NO and a molecular weight of 320.06 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide.
| Compound Name | N,N-bis(2-chloroethyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 103310045 |
| Molecular Formula | C8H9Cl2F6NO |
| Molecular Weight | 320.06 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | N,N-bis(2-chloroethyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| SMILES | O=C(C(C(F)(F)F)C(F)(F)F)N(CCCl)CCCl |
| InChI | InChI=1S/C8H9Cl2F6NO/c9-1-3-17(4-2-10)6(18)5(7(11,12)13)8(14,15)16/h5H,1-4H2 |
| InChIKey | HOWHWNRFTNKSFM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.06 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|