C9H12F6N2OS — CID 103309906
N-(2-amino-2-sulfanylideneethyl)-3,3,3-trifluoro-N-propyl-2-(trifluoromethyl)propanamide (PubChem CID 103309906) has the molecular formula C9H12F6N2OS and a molecular weight of 310.26 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-3,3,3-trifluoro-N-propyl-2-(trifluoromethyl)propanamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-3,3,3-trifluoro-N-propyl-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 103309906 |
| Molecular Formula | C9H12F6N2OS |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-3,3,3-trifluoro-N-propyl-2-(trifluoromethyl)propanamide |
| SMILES | CCCN(CC(N)=S)C(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H12F6N2OS/c1-2-3-17(4-5(16)19)7(18)6(8(10,11)12)9(13,14)15/h6H,2-4H2,1H3,(H2,16,19) |
| InChIKey | KSSMQSSVNZSVEL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|