C9H13F6N3O2 — CID 103310813
N-(3-amino-3-hydroxyiminopropyl)-N-ethyl-3,3,3-trifluoro-2-(trifluoromethyl)propanamide (PubChem CID 103310813) has the molecular formula C9H13F6N3O2 and a molecular weight of 309.21 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyiminopropyl)-N-ethyl-3,3,3-trifluoro-2-(trifluoromethyl)propanamide.
| Compound Name | N-(3-amino-3-hydroxyiminopropyl)-N-ethyl-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 103310813 |
| Molecular Formula | C9H13F6N3O2 |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N-(3-amino-3-hydroxyiminopropyl)-N-ethyl-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| SMILES | CCN(CCC(N)=NO)C(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H13F6N3O2/c1-2-18(4-3-5(16)17-20)7(19)6(8(10,11)12)9(13,14)15/h6,20H,2-4H2,1H3,(H2,16,17) |
| InChIKey | FVPQKXTUMBFNDQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|