C8H13F4NO3 — CID 103915709
2,2,3,3-tetrafluoro-N-(2-hydroxyethyl)-N-(2-methoxyethyl)propanamide (PubChem CID 103915709) has the molecular formula C8H13F4NO3 and a molecular weight of 247.19 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(2-hydroxyethyl)-N-(2-methoxyethyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(2-hydroxyethyl)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 103915709 |
| Molecular Formula | C8H13F4NO3 |
| Molecular Weight | 247.19 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(2-hydroxyethyl)-N-(2-methoxyethyl)propanamide |
| SMILES | COCCN(CCO)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H13F4NO3/c1-16-5-3-13(2-4-14)7(15)8(11,12)6(9)10/h6,14H,2-5H2,1H3 |
| InChIKey | QAJHZXDXEMORBV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.19 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|