About (2S)-N,N-bis(2-hydroxyethyl)-3,3-dimethyl-2-propan-2-ylbutanamide
(2S)-N,N-bis(2-hydroxyethyl)-3,3-dimethyl-2-propan-2-ylbutanamide (PubChem CID 87847862) has the molecular formula C13H27NO3
and a molecular weight of 245.36 g/mol. Its IUPAC name is (2S)-N,N-bis(2-hydroxyethyl)-3,3-dimethyl-2-propan-2-ylbutanamide.
Molecular Properties
| Compound Name | (2S)-N,N-bis(2-hydroxyethyl)-3,3-dimethyl-2-propan-2-ylbutanamide |
| PubChem CID | 87847862 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | (2S)-N,N-bis(2-hydroxyethyl)-3,3-dimethyl-2-propan-2-ylbutanamide |
| SMILES | CC(C)[C@H](C(=O)N(CCO)CCO)C(C)(C)C |
| InChI | InChI=1S/C13H27NO3/c1-10(2)11(13(3,4)5)12(17)14(6-8-15)7-9-16/h10-11,15-16H,6-9H2,1-5H3/t11-/m1/s1 |
| InChIKey | KLFAMMSRQXUKQP-LLVKDONJSA-N |
| XLogP | 1.12 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-N,N-bis(2-hydroxyethyl)-3,3-dimethyl-2-propan-2-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N-bis(2-hydroxyethyl)-3,3-dimethyl-2-propan-2-ylbutanamide?
The IUPAC name of (2S)-N,N-bis(2-hydroxyethyl)-3,3-dimethyl-2-propan-2-ylbutanamide (CID 87847862) is (2S)-N,N-bis(2-hydroxyethyl)-3,3-dimethyl-2-propan-2-ylbutanamide.
What is the SMILES notation for (2S)-N,N-bis(2-hydroxyethyl)-3,3-dimethyl-2-propan-2-ylbutanamide?
The canonical SMILES for (2S)-N,N-bis(2-hydroxyethyl)-3,3-dimethyl-2-propan-2-ylbutanamide is CC(C)[C@H](C(=O)N(CCO)CCO)C(C)(C)C.
What is the InChIKey of (2S)-N,N-bis(2-hydroxyethyl)-3,3-dimethyl-2-propan-2-ylbutanamide?
The InChIKey is KLFAMMSRQXUKQP-LLVKDONJSA-N. The full InChI is InChI=1S/C13H27NO3/c1-10(2)11(13(3,4)5)12(17)14(6-8-15)7-9-16/h10-11,15-16H,6-9H2,1-5H3/t11-/m1/s1.
What are the key properties of (2S)-N,N-bis(2-hydroxyethyl)-3,3-dimethyl-2-propan-2-ylbutanamide?
(2S)-N,N-bis(2-hydroxyethyl)-3,3-dimethyl-2-propan-2-ylbutanamide has a molecular weight of 245.36 g/mol, XLogP of 1.12, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N-bis(2-hydroxyethyl)-3,3-dimethyl-2-propan-2-ylbutanamide is sourced from PubChem (CID 87847862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).