C15H22ClNO3 — CID 60653667
2-(4-chlorophenyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide (PubChem CID 60653667) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide.
| Compound Name | 2-(4-chlorophenyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 60653667 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)N(CCO)CCO)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H22ClNO3/c1-11(2)14(12-3-5-13(16)6-4-12)15(20)17(7-9-18)8-10-19/h3-6,11,14,18-19H,7-10H2,1-2H3 |
| InChIKey | VRFXQZCPNPYLAX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |