C24H24Cl2F6 — CID 158152787
1-chloro-4-(1,1,2-trifluoro-4-methylpent-1-en-3-yl)benzene (PubChem CID 158152787) has the molecular formula C24H24Cl2F6 and a molecular weight of 497.35 g/mol. Its IUPAC name is 1-chloro-4-(1,1,2-trifluoro-4-methylpent-1-en-3-yl)benzene.
| Compound Name | 1-chloro-4-(1,1,2-trifluoro-4-methylpent-1-en-3-yl)benzene |
|---|---|
| PubChem CID | 158152787 |
| Molecular Formula | C24H24Cl2F6 |
| Molecular Weight | 497.35 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 1-chloro-4-(1,1,2-trifluoro-4-methylpent-1-en-3-yl)benzene |
| SMILES | CC(C)C(C(F)=C(F)F)c1ccc(Cl)cc1.CC(C)C(C(F)=C(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/2C12H12ClF3/c2*1-7(2)10(11(14)12(15)16)8-3-5-9(13)6-4-8/h2*3-7,10H,1-2H3 |
| InChIKey | FVHZTWMIJPMQBQ-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.35 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |